CAS 868271-05-0
:5-Bromo-2-[[(1-methylethylidene)amino]oxy]benzonitrile
Description:
5-Bromo-2-[[(1-methylethylidene)amino]oxy]benzonitrile is a chemical compound characterized by its complex structure, which includes a bromine atom, a nitrile group, and an aminooxy functional group. The presence of the bromine atom typically enhances the compound's reactivity and can influence its biological activity. The nitrile group (-C≡N) contributes to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions. The aminooxy group (-NH-O-) is known for its ability to form stable linkages with carbonyl compounds, making it useful in various synthetic applications. This compound may exhibit specific biological activities, potentially making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, its solubility, stability, and reactivity will depend on the surrounding conditions, such as pH and solvent polarity. Safety data and handling precautions should be considered when working with this substance, as with any chemical compound.
Formula:C10H9BrN2O
InChI:InChI=1S/C10H9BrN2O/c1-7(2)13-14-10-4-3-9(11)5-8(10)6-12/h3-5H,1-2H3
InChI key:InChIKey=FITREKCGPGPMEC-UHFFFAOYSA-N
SMILES:O(N=C(C)C)C1=C(C#N)C=C(Br)C=C1
Synonyms:- 5-Bromo-2-[[(1-methylethylidene)amino]oxy]benzonitrile
- Benzonitrile, 5-bromo-2-[[(1-methylethylidene)amino]oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
