CAS 868273-06-7
:5-Chloro-3-ethyl-N-[2-[4-(1-piperidinyl)phenyl]ethyl]-1H-indole-2-carboxamide
Description:
5-Chloro-3-ethyl-N-[2-[4-(1-piperidinyl)phenyl]ethyl]-1H-indole-2-carboxamide, with the CAS number 868273-06-7, is a synthetic organic compound characterized by its complex structure, which includes an indole core, a chloro substituent, and a piperidine moiety. This compound typically exhibits properties associated with indole derivatives, such as potential biological activity, including interactions with various receptors or enzymes. The presence of the chloro group may influence its lipophilicity and reactivity, while the ethyl and piperidinyl groups can enhance its pharmacological profile. The compound is likely to be soluble in organic solvents and may have moderate to low solubility in water, depending on its specific functional groups. Its potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or oncological conditions. As with many compounds of this nature, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C24H28ClN3O
InChI:InChI=1S/C24H28ClN3O/c1-2-20-21-16-18(25)8-11-22(21)27-23(20)24(29)26-13-12-17-6-9-19(10-7-17)28-14-4-3-5-15-28/h6-11,16,27H,2-5,12-15H2,1H3,(H,26,29)
InChI key:InChIKey=AHFZDNYNXFMRFQ-UHFFFAOYSA-N
SMILES:C(C)C=1C=2C(NC1C(NCCC3=CC=C(C=C3)N4CCCCC4)=O)=CC=C(Cl)C2
Synonyms:- 1H-Indole-2-carboxamide, 5-chloro-3-ethyl-N-[2-[4-(1-piperidinyl)phenyl]ethyl]-
- 5-Chloro-3-Ethyl-1H-Indole-2-Carboxylic Acid [2-(4-Piperidin-1-Yl-Phenyl)-Ethyl]-Amide
- 5-Chloro-3-ethyl-N-[2-[4-(1-piperidinyl)phenyl]ethyl]-1H-indole-2-carboxamide
- Org-27569
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Org 27569
CAS:Org 27569, an allosteric modulator of cannabinoid CB1 receptor, can induce a CB1 receptor state that is characterized by decreased inverse agonist affinity andFormula:C24H28ClN3OPurity:>99.99% - ≥95%Color and Shape:SolidMolecular weight:409.95Org 27569
CAS:Controlled ProductOrg 27569 is a cannabinoid that binds to the CB2 receptor, which is found in peripheral tissue. The drug has shown to be effective in vitro and in vivo against animal models of seizures and convulsions. It has also been shown to have pharmacokinetic properties that are different from other cannabinoids, including a longer half-life and increased bioavailability. Org 27569 binds to the CB1 receptor, but does not activate it. This drug also has an allosteric effect on fatty acid binding sites, which may lead to its potential use for treating obesity or diabetes.Formula:C24H28ClN3OPurity:Min. 95%Molecular weight:409.95 g/mol




