CAS 868362-18-9

8-Bromo-[1,2,4]triazolo[1,5-a]pyridine

Description:

8-Bromo-[1,2,4]triazolo[1,5-a]pyridine is a heterocyclic compound characterized by its unique triazole and pyridine ring structures. This compound features a bromine atom at the 8-position of the triazole ring, which can influence its reactivity and biological activity. The presence of the triazole moiety often imparts significant pharmacological properties, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure allows for potential interactions with various biological targets, making it a candidate for research in drug development. Additionally, the bromine substituent can enhance lipophilicity and alter the electronic properties of the molecule, which may affect its binding affinity and selectivity. Safety and handling precautions should be observed due to the potential toxicity associated with brominated compounds. Overall, 8-Bromo-[1,2,4]triazolo[1,5-a]pyridine represents a valuable compound for further exploration in chemical and pharmaceutical research.

Formula: C₆H₄BrN₃

InChI: InChI=1/C6H4BrN3/c7-5-2-1-3-10-6(5)8-4-9-10/h1-4H

SMILES: c1cc(c2ncnn2c1)Br

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyridine, 8-bromo-
• 8-Bromo[1,2,4]triazolo[1,5-a]pyridine

8-Bromo-[1,2,4]triazolo[1,5-a]pyridine

CAS: 868362-18-9

Formula: C₆H₄BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 198.0201

Ref: IN-DA004IQS

8-Bromo[1,2,4]triazolo[1,5-a]pyridine

CAS: 868362-18-9

8-Bromo[1,2,4]triazolo[1,5-a]pyridine

Formula: C₆H₄BrN₃

Purity: 95%

Color and Shape: beige solid

Molecular weight: 198.02g/mol

Ref: 54-OR55245

8-Bromo[1,2,4]triazolo[1,5-a]pyridine

CAS: 868362-18-9

Formula: C₆H₄BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 198.023

Ref: 10-F236612