CAS 868387-45-5
:tert-butyl N-(4-bromo-2-thienyl)carbamate
Description:
Tert-butyl N-(4-bromo-2-thienyl)carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonic acid derivative. This compound features a tert-butyl group, providing steric hindrance and enhancing its lipophilicity, which can influence its solubility and reactivity. The presence of the 4-bromo-2-thienyl moiety introduces a bromine atom and a thiophene ring, contributing to the compound's potential biological activity and electronic properties. The bromine atom can serve as a site for further chemical modifications or reactions, while the thiophene ring may impart unique electronic characteristics, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents on the thiophene ring. Overall, tert-butyl N-(4-bromo-2-thienyl)carbamate is a versatile compound with potential applications in synthetic chemistry and medicinal chemistry.
Formula:C9H12BrNO2S
InChI:InChI=1/C9H12BrNO2S/c1-9(2,3)13-8(12)11-7-4-6(10)5-14-7/h4-5H,1-3H3,(H,11,12)
SMILES:CC(C)(C)OC(=O)Nc1cc(cs1)Br
Synonyms:- tert-Butyl (4-bromo-2-thienyl)carbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
tert-Butyl (4-bromothiophen-2-yl)carbamate
CAS:Formula:C9H12BrNO2SPurity:97%Color and Shape:SolidMolecular weight:278.1661tert-Butyl (4-bromothiophen-2-yl)carbamate
CAS:tert-Butyl (4-bromothiophen-2-yl)carbamatePurity:95%Molecular weight:278.17g/moltert-Butyl (4-Bromothiophen-2-yl)carbamate
CAS:Formula:C9H12BrNO2SPurity:>98.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:278.16tert-Butyl (4-bromothiophen-2-yl)carbamate
CAS:Formula:C9H12BrNO2SPurity:97%Color and Shape:SolidMolecular weight:278.16N-(4-Bromo-2-thienyl)-carbamic Acid 1,1-Dimethylethyl Ester
CAS:Controlled ProductApplications N-(4-bromo-2-thienyl)-carbamic Acid 1,1-Dimethylethyl Ester, is an intermediate for the synthesis of bicyclic inhibitors of ROCK protein kinsae.
References Hahmann, C. et al.: Cell. Mol. Life Sci., 67, 171 (2010);Formula:C9H12BrNO2SColor and Shape:NeatMolecular weight:278.166




