CAS 868394-59-6
:4′-Carboxy[1,1′-biphenyl]-4-acetic acid
Description:
4′-Carboxy[1,1′-biphenyl]-4-acetic acid, identified by its CAS number 868394-59-6, is an organic compound characterized by its biphenyl structure with a carboxylic acid functional group and an acetic acid moiety. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, and a carboxylic acid group (-COOH) at one end, along with an acetic acid side chain. The presence of these functional groups contributes to its potential as a ligand in coordination chemistry and its utility in organic synthesis. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. Additionally, it may display acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Its structural characteristics suggest potential applications in pharmaceuticals, materials science, and as an intermediate in organic synthesis. However, specific reactivity and stability would depend on the conditions under which it is used.
Formula:C15H12O4
InChI:InChI=1S/C15H12O4/c16-14(17)9-10-1-3-11(4-2-10)12-5-7-13(8-6-12)15(18)19/h1-8H,9H2,(H,16,17)(H,18,19)
InChI key:InChIKey=OKPOZLAJLVCWLC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(C=C1)C2=CC=C(CC(O)=O)C=C2
Synonyms:- 4′-Carboxy[1,1′-biphenyl]-4-acetic acid
- [1,1′-Biphenyl]-4-acetic acid, 4′-carboxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
