
CAS 86843-99-4
:6-Bromo-2-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyridine
Description:
6-Bromo-2-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyridine is a heterocyclic compound characterized by the presence of a triazole ring fused to a pyridine structure, along with a bromine atom and a para-methylphenyl substituent. This compound typically exhibits a range of chemical properties due to its functional groups, including potential reactivity in electrophilic substitution reactions due to the bromine atom. The triazole moiety contributes to its stability and may enhance its biological activity, making it of interest in pharmaceutical research. The presence of the methylphenyl group can influence its solubility and lipophilicity, which are important for its potential applications in drug development. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, 6-Bromo-2-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyridine represents a versatile structure with potential applications in medicinal chemistry and material science.
Formula:C13H10BrN3
InChI:InChI=1S/C13H10BrN3/c1-9-2-4-10(5-3-9)13-15-12-7-6-11(14)8-17(12)16-13/h2-8H,1H3
InChI key:InChIKey=YYDJXGOVNDHFNZ-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=2N=C3N(N2)C=C(Br)C=C3)C=C1
Synonyms:- 6-Bromo-2-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyridine
- [1,2,4]Triazolo[1,5-a]pyridine, 6-bromo-2-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.