CAS 86845-28-5
:1-Bromo-3-methyl-5-(trifluoromethyl)benzene
Description:
1-Bromo-3-methyl-5-(trifluoromethyl)benzene, with the CAS number 86845-28-5, is an aromatic compound characterized by the presence of a bromine atom, a methyl group, and a trifluoromethyl group attached to a benzene ring. This compound features a bromine substituent at the first position, a methyl group at the third position, and a trifluoromethyl group at the fifth position of the benzene ring, contributing to its unique reactivity and properties. The trifluoromethyl group is known for its electron-withdrawing effects, which can influence the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of the bromine atom can facilitate nucleophilic substitution reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as boiling point and solubility, are influenced by the substituents on the benzene ring, making it a compound of interest in both industrial and research applications.
Formula:C8H6BrF3
InChI:InChI=1/C8H6BrF3/c1-5-2-6(8(10,11)12)4-7(9)3-5/h2-4H,1H3
SMILES:Cc1cc(cc(c1)Br)C(F)(F)F
Synonyms:- Benzene, 1-bromo-3-methyl-5-(trifluoromethyl)-
- 3-Bromo-5-(Trifluoromethyl)Toluene
- 3-Bromo-5-methylbenzotrifluoride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Bromo-5-(trifluoromethyl)toluene
CAS:Formula:C8H6BrF3Purity:98%Color and Shape:LiquidMolecular weight:239.0324Ref: IN-DA004QWM
1g26.00€5g56.00€10g71.00€1kgTo inquire25g144.00€2kgTo inquire50g189.00€100g508.00€250mg20.00€3-Bromo-5-methylbenzotrifluoride
CAS:3-Bromo-5-methylbenzotrifluorideFormula:C8H6BrF3Purity:99%Color and Shape: clear. colourless liquidMolecular weight:239.03g/mol3-Bromo-5-(trifluoromethyl)toluene
CAS:3-Bromo-5-(trifluoromethyl)toluene is a hydrolase enzyme that can hydrolyze the ester bonds in 3-bromo-5-(trifluoromethyl)toluene and other compounds. The enzyme has been shown to be active against gram-negative bacteria, including Klebsiella pneumoniae. It is not active against gram-positive bacteria such as Staphylococcus aureus or Streptococcus pneumoniae. This enzyme is classified as an antibiotic resistance framework because it can modify certain antibiotics, such as piperazine and analogs, by converting them into ligands for the active site of the enzyme. 3BFT also has biosynthesis activity in which it converts pyrophosphate to ATP and PPi.Formula:C8H6BrF3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:239.03 g/mol3-Bromo-5-methylbenzotrifluoride
CAS:Formula:C8H6BrF3Purity:98%Color and Shape:Liquid, ClearMolecular weight:239.035



