CAS 86845-31-0

1-[(4-Nitrophenyl)methyl]-3-(trifluoromethyl)benzene

Description:

1-[(4-Nitrophenyl)methyl]-3-(trifluoromethyl)benzene, with the CAS number 86845-31-0, is an organic compound characterized by its complex aromatic structure. It features a trifluoromethyl group, which is known for its electron-withdrawing properties, enhancing the compound's reactivity and influencing its physical and chemical properties. The presence of the nitrophenyl group contributes to its potential as a chromophore, making it useful in various applications, including dyes and pigments. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals and agrochemicals due to the presence of functional groups that can participate in further chemical reactions. Additionally, the compound's stability and reactivity can be influenced by the electron-withdrawing trifluoromethyl group and the electron-donating nitro group, making it a subject of interest in synthetic organic chemistry. Safety data should be consulted for handling, as compounds with nitro groups can pose health risks.

Formula: C₁₄H₁₀F₃NO₂

InChI: InChI=1S/C14H10F3NO2/c15-14(16,17)12-3-1-2-11(9-12)8-10-4-6-13(7-5-10)18(19)20/h1-7,9H,8H2

InChI key: InChIKey=BVMZOVZSFBBWPO-UHFFFAOYSA-N

SMILES: C(C1=CC(C(F)(F)F)=CC=C1)C2=CC=C(N(=O)=O)C=C2

Synonyms:

• (4-Nitrophenyl)-(3-trifluoromethyl-phenyl)-methane
• Benzene, 1-[(4-nitrophenyl)methyl]-3-(trifluoromethyl)-
• 1-[(4-Nitrophenyl)methyl]-3-(trifluoromethyl)benzene