CAS 86847-67-8

N-[3-(Hydroxyphenylmethyl)-2-pyridinyl]-2,2-dimethylpropanamide

Description:

N-[3-(Hydroxyphenylmethyl)-2-pyridinyl]-2,2-dimethylpropanamide, with CAS number 86847-67-8, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a hydroxyphenylmethyl group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the hydroxyl group. The presence of the dimethylpropanamide moiety suggests that it may have steric hindrance, influencing its reactivity and interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological activities, which could include effects on neurotransmitter systems or other biological pathways. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature references for precise values. Overall, this compound represents a unique structure that may contribute to its biological activity and potential applications in drug development.

Formula: C₁₇H₂₀N₂O₂

InChI: InChI=1S/C17H20N2O2/c1-17(2,3)16(21)19-15-13(10-7-11-18-15)14(20)12-8-5-4-6-9-12/h4-11,14,20H,1-3H3,(H,18,19,21)

InChI key: InChIKey=SOXFRJCJASVFDB-UHFFFAOYSA-N

SMILES: C(O)(C1=C(NC(C(C)(C)C)=O)N=CC=C1)C2=CC=CC=C2

Synonyms:

• Propanamide, N-[3-(hydroxyphenylmethyl)-2-pyridinyl]-2,2-dimethyl-
• N-[3-(Hydroxyphenylmethyl)-2-pyridinyl]-2,2-dimethylpropanamide

2-Pivaloylamino-3-(α-hydroxybenzyl)pyridine

Controlled Product

CAS: 86847-67-8

Applications 2-Pivaloylamino-3-(α-hydroxybenzyl)pyridine (cas# 86847-67-8) is a compound useful in organic synthesis.

Formula: C₁₇H₂₀N₂O₂

Color and Shape: Neat

Molecular weight: 284.35

Ref: TR-P550680