CAS 86847-70-3

2,2-dimethyl-N-[3-(trimethylsilyl)pyridin-4-yl]propanamide

Description:

2,2-Dimethyl-N-[3-(trimethylsilyl)pyridin-4-yl]propanamide, with the CAS number 86847-70-3, is an organic compound characterized by its unique structural features. It contains a propanamide backbone, which is modified by the presence of two methyl groups at the 2-position and a pyridine ring substituted with a trimethylsilyl group at the 3-position. This compound exhibits properties typical of amides, such as potential hydrogen bonding capabilities due to the carbonyl group, which can influence its solubility and reactivity. The trimethylsilyl group enhances the compound's stability and may improve its lipophilicity, making it useful in various chemical applications, including as a ligand in coordination chemistry or as a precursor in organic synthesis. Additionally, the presence of the pyridine moiety may impart specific electronic properties, making it suitable for applications in pharmaceuticals or agrochemicals. Overall, this compound's unique structure contributes to its potential utility in various chemical and biological contexts.

Formula: C₁₃H₂₂N₂OSi

InChI: InChI=1/C13H22N2OSi/c1-13(2,3)12(16)15-10-7-8-14-9-11(10)17(4,5)6/h7-9H,1-6H3,(H,14,15,16)

SMILES: CC(C)(C)C(=O)N=c1cc[nH]cc1[Si](C)(C)C