CAS 86847-91-8

3-[(2,2-dimethylpropanoyl)amino]pyridine-4-carboxylic acid

Description:

3-[(2,2-Dimethylpropanoyl)amino]pyridine-4-carboxylic acid, with the CAS number 86847-91-8, is a chemical compound that features a pyridine ring substituted with both an amino group and a carboxylic acid group, making it an amino acid derivative. The presence of the 2,2-dimethylpropanoyl group introduces steric hindrance, which can influence the compound's reactivity and interactions. This compound is likely to exhibit properties typical of both pyridine derivatives and amino acids, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the carboxylic acid and amino functionalities. Its structure suggests it may have applications in pharmaceuticals or as a biochemical probe, although specific biological activities would depend on further studies. Additionally, the compound's stability, melting point, and solubility characteristics would need to be evaluated experimentally to fully understand its behavior in various environments.

Formula: C₁₁H₁₄N₂O₃

InChI: InChI=1/C11H14N2O3/c1-11(2,3)10(16)13-8-6-12-5-4-7(8)9(14)15/h4-6H,1-3H3,(H,13,16)(H,14,15)

SMILES: CC(C)(C)C(=Nc1cnccc1C(=O)O)O

3-(Pivaloylamino)isonicotinic acid

CAS: 86847-91-8

Formula: C₁₁H₁₄N₂O₃

Purity: 95%

Molecular weight: 222.2405

Ref: IN-DA004M7J