CAS 86849-77-6

5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxy-4H-chromen-4-one

Description:

5,7-Dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxy-4H-chromen-4-one, with the CAS number 86849-77-6, is a flavonoid compound characterized by its chromone backbone, which is a common structural motif in many natural products. This compound features multiple hydroxyl (-OH) groups and a methoxy (-OCH3) group, contributing to its potential antioxidant properties. The presence of these functional groups enhances its ability to scavenge free radicals and may influence its biological activity, including anti-inflammatory and anticancer effects. The compound's structure suggests it may interact with various biological pathways, making it of interest in pharmacological research. Additionally, its solubility and stability can be affected by the presence of these substituents, which is crucial for its application in medicinal chemistry. Overall, 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxy-4H-chromen-4-one represents a significant compound in the study of flavonoids and their potential health benefits.

Formula: C₁₇H₁₄O₇

InChI: InChI=1/C17H14O7/c1-22-12-4-3-8(5-10(12)18)9-7-24-13-6-11(19)17(23-2)16(21)14(13)15(9)20/h3-7,18-19,21H,1-2H3

SMILES: COc1ccc(cc1O)c1coc2cc(c(c(c2c1=O)O)OC)O

Synonyms:

• Iristectorin A

5,7-Dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one

CAS: 86849-77-6

Formula: C₁₇H₁₄O₇

Purity: 95%

Molecular weight: 330.2889

Ref: IN-DA00H09T

Iristectorigenin B

CAS: 86849-77-6

Iristectorigenin B

Purity: ≥98%

Molecular weight: 330.29g/mol

Ref: 54-BUP21800

Iristectorigenin B

CAS: 86849-77-6

Formula: C₁₇H₁₄O₇

Purity: 95%~99%

Molecular weight: 330.292

Ref: BP-BP4181

Iristectorigenin B

CAS: 86849-77-6

Iristectorigenin B (Iristectrigenin B), a Belamcanda-derived liver X receptor (LXR) modulator, promotes the expression of ABCA264 and ABCG7.

Formula: C₁₇H₁₄O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 330.29

Ref: TM-TN2359

Iristectorigenin B

CAS: 86849-77-6

Iristectorigenin B is a naturally occurring isoflavone, which is a type of phytochemical compound found mainly in plants. This compound is isolated primarily from Iris species. Isoflavones like Iristectorigenin B are known for their role in plant development and defense mechanisms.

Formula: C₁₇H₁₄O₇

Purity: Min. 95%

Molecular weight: 330.29 g/mol

Ref: 3D-FI58222