CAS 86850-72-8
:tritricosanoin (C23:0)
Description:
Tritricosanoin, also known by its chemical formula C23:0, is a triglyceride derived from tritriacontanoic acid, a long-chain fatty acid. It is characterized by its structure, which consists of a glycerol backbone esterified with three molecules of tritriacontanoic acid. This substance is typically a colorless to pale yellow liquid or solid at room temperature, depending on its specific formulation and purity. Tritricosanoin is known for its emollient properties, making it useful in cosmetic and personal care formulations, where it can enhance skin feel and moisture retention. Additionally, it has potential applications in food and pharmaceutical industries due to its stability and compatibility with various formulations. Its relatively high molecular weight and long carbon chain contribute to its low volatility and high viscosity. As with many long-chain triglycerides, tritricosanoin is generally considered safe for use in consumer products, although specific regulatory assessments may apply depending on the intended application.
Formula:C72H140O6
InChI:InChI=1/C72H140O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-55-58-61-64-70(73)76-67-69(78-72(75)66-63-60-57-54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)68-77-71(74)65-62-59-56-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h69H,4-68H2,1-3H3
SMILES:CCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCCC
Synonyms:- Propane-1,2,3-Triyl Tritricosanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Tritricosanoin
CAS:Saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides etc, nesoiFormula:C72H140O6Color and Shape:White PowderMolecular weight:1101.06499Tricosanoic Acid 1,2,3-Propanetriyl Ester
CAS:Controlled ProductApplications Tricosanoic Acid 1,2,3-Propanetriyl Ester, can be used for the manufacture of cosmetics, and perfumes.
References Oro, L., et al.: Acta Pharmacol. Toxicol., 18, 141 (1961),Formula:C72H140O6Color and Shape:NeatMolecular weight:1101.881,2,3-Tritricosanoyl Glycerol
CAS:1,2,3-Tritricosanoyl glycerol, a triacylglycerol containing tricosanoic acid at the sn-1, sn-2, and sn-3 positions, serves as an internal standard for the quantification of fatty acids within the triglyceride component of human aortic endothelial cells (HAECs) cultured in media supplemented with stearic and/or oleic acid.Formula:C72H140O6Color and Shape:SolidMolecular weight:1101.88





