CymitQuimica logo

CAS 868540-77-6

:

methyl 3-iodo-4-(methylamino)benzoate

Description:
Methyl 3-iodo-4-(methylamino)benzoate, with the CAS number 868540-77-6, is an organic compound characterized by its structure, which includes a benzoate moiety substituted with an iodine atom and a methylamino group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is soluble in organic solvents, reflecting its non-polar characteristics, while its polar functional groups may impart some degree of solubility in polar solvents. The presence of the iodine atom suggests potential reactivity in nucleophilic substitution reactions, while the methylamino group can participate in various chemical transformations, including alkylation and acylation. Methyl 3-iodo-4-(methylamino)benzoate may be of interest in medicinal chemistry and drug development due to its potential biological activity, particularly in the context of designing compounds that interact with biological targets. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C9H10INO2
InChI:InChI=1/C9H10INO2/c1-11-8-4-3-6(5-7(8)10)9(12)13-2/h3-5,11H,1-2H3
SMILES:CNc1ccc(cc1I)C(=O)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.