CymitQuimica logo

CAS 868594-51-8

:

9H-Fluoren-9-ylmethyl 28-hydroxy-5,8,11,14,17,20,23,26-octaoxa-2-azaoctacosanoate

Description:
9H-Fluoren-9-ylmethyl 28-hydroxy-5,8,11,14,17,20,23,26-octaoxa-2-azaoctacosanoate is a complex organic compound characterized by its unique structure, which includes a fluorenylmethyl group and a long-chain polyether segment. The presence of multiple ether linkages (octaoxa) contributes to its solubility in various organic solvents, while the azole moiety introduces potential for hydrogen bonding and interaction with biological systems. The hydroxyl group enhances its polarity, which may influence its reactivity and interaction with other chemical species. This compound may exhibit interesting properties such as surfactant behavior, making it potentially useful in applications like drug delivery, where its ability to form micelles or interact with biological membranes could be advantageous. Additionally, the structural complexity suggests potential for diverse functionalization, allowing for tailored properties in specific applications. Overall, the characteristics of this compound make it a subject of interest in both synthetic chemistry and materials science.
Formula:C33H49NO11
InChI:InChI=1S/C33H49NO11/c35-10-12-38-14-16-40-18-20-42-22-24-44-26-25-43-23-21-41-19-17-39-15-13-37-11-9-34-33(36)45-27-32-30-7-3-1-5-28(30)29-6-2-4-8-31(29)32/h1-8,32,35H,9-27H2,(H,34,36)
InChI key:InChIKey=KHBAZZMFHYCZSW-UHFFFAOYSA-N
SMILES:C(OC(NCCOCCOCCOCCOCCOCCOCCOCCOCCO)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:
  • 9H-Fluoren-9-ylmethyl 28-hydroxy-5,8,11,14,17,20,23,26-octaoxa-2-azaoctacosanoate
  • 5,8,11,14,17,20,23,26-Octaoxa-2-azaoctacosanoic acid, 28-hydroxy-, 9H-fluoren-9-ylmethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.