CAS 86864-87-1
:2,4-Dimethylphenyl diphenyl phosphate
Description:
2,4-Dimethylphenyl diphenyl phosphate, with the CAS number 86864-87-1, is an organophosphate compound characterized by its phosphate ester structure. It features two phenyl groups and a dimethyl-substituted phenyl group, contributing to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is known for its applications as a flame retardant and plasticizer in various materials, enhancing their thermal stability and reducing flammability. The presence of the phosphate group imparts certain hydrophilic characteristics, while the aromatic rings contribute to its hydrophobic nature, influencing its solubility in organic solvents. Additionally, 2,4-Dimethylphenyl diphenyl phosphate exhibits moderate toxicity, necessitating careful handling and adherence to safety protocols during use. Its environmental impact and potential for bioaccumulation are also considerations in its application and regulation. Overall, this compound plays a significant role in industrial applications, particularly in the production of polymers and coatings.
Formula:C20H19O4P
InChI:InChI=1S/C20H19O4P/c1-16-13-14-20(17(2)15-16)24-25(21,22-18-9-5-3-6-10-18)23-19-11-7-4-8-12-19/h3-15H,1-2H3
InChI key:InChIKey=AYGJSQLTGPQJPU-UHFFFAOYSA-N
SMILES:P(OC1=C(C)C=C(C)C=C1)(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O
Synonyms:- Phenyl 2,4-xylyl phosphate ((PhO)2(C8H9O)PO)
- 2,4-Dimethylphenyl diphenyl phosphate
- Phosphoric acid, 2,4-dimethylphenyl diphenyl ester
- phosphoric acid, 2,4-dimethylphenyl diphenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4-Dimethylphenyl diphenyl phosphate
CAS:Controlled ProductFormula:C20H19O4PColor and Shape:NeatMolecular weight:386.42
