CAS 868662-63-9
:2-(Trifluoromethyl)-7-quinolinecarboxylic acid
Description:
2-(Trifluoromethyl)-7-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a trifluoromethyl group (-CF3) at the 2-position significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. The carboxylic acid functional group (-COOH) at the 7-position contributes to its acidity and reactivity, allowing for various chemical transformations and interactions. This compound is often utilized in medicinal chemistry and research due to its potential as a building block for pharmaceuticals or agrochemicals. Its unique electronic properties, imparted by the trifluoromethyl group, can affect the compound's reactivity and solubility in different solvents. Additionally, the presence of fluorine atoms can enhance metabolic stability and influence the pharmacokinetics of derivatives. Overall, 2-(Trifluoromethyl)-7-quinolinecarboxylic acid is a versatile compound with applications in various fields, including drug development and material science.
Formula:C11H6F3NO2
InChI:InChI=1S/C11H6F3NO2/c12-11(13,14)9-4-3-6-1-2-7(10(16)17)5-8(6)15-9/h1-5H,(H,16,17)
InChI key:InChIKey=WEFALJALMGHWBI-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NC2=C(C=C1)C=CC(C(O)=O)=C2
Synonyms:- 2-(Trifluoromethyl)-7-quinolinecarboxylic acid
- 2-Trifluoromethylquinoline-7-carboxylic acid
- 7-Quinolinecarboxylic acid, 2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.