CymitQuimica logo

CAS 868692-49-3

:

4-fluoro-2-iodo-5-(trifluoromethyl)aniline

Description:
4-Fluoro-2-iodo-5-(trifluoromethyl)aniline is an organic compound characterized by the presence of a fluorine atom, an iodine atom, and a trifluoromethyl group attached to an aniline structure. This compound features a benzene ring with an amino group (-NH2) that is substituted at the para position with a fluorine atom and at the ortho position with an iodine atom, while a trifluoromethyl group (-CF3) is located at the meta position relative to the amino group. The presence of these halogen substituents significantly influences the compound's chemical properties, including its reactivity and polarity. The trifluoromethyl group, in particular, is known for imparting unique electronic characteristics, making the compound potentially useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the iodine atom can facilitate further chemical transformations, while the fluorine atom can enhance the compound's stability and lipophilicity. Overall, this compound is of interest in synthetic chemistry and material science due to its distinctive structural features and potential utility.
Formula:C7H4F4IN
InChI:InChI=1/C7H4F4IN/c8-4-2-5(12)6(13)1-3(4)7(9,10)11/h1-2H,13H2
SMILES:c1c(c(cc(c1N)I)F)C(F)(F)F
Synonyms:
  • Benzenamine, 4-Fluoro-2-Iodo-5-(Trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.