CAS 868694-20-6
:6-Chloro-3-iodo-1H-indole
Description:
6-Chloro-3-iodo-1H-indole is a heterocyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of chlorine and iodine substituents at the 6 and 3 positions, respectively, contributes to its unique chemical properties and reactivity. This compound typically appears as a solid and is soluble in organic solvents, reflecting its non-polar characteristics. It is often utilized in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The halogen substituents can influence the compound's electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's structure allows for potential interactions with biological targets, which is of interest in drug design and development. Safety data should be consulted, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact. Overall, 6-Chloro-3-iodo-1H-indole is a significant compound in the field of organic synthesis and medicinal chemistry.
Formula:C8H5ClIN
InChI:InChI=1S/C8H5ClIN/c9-5-1-2-6-7(10)4-11-8(6)3-5/h1-4,11H
InChI key:InChIKey=PCPATSPUGNLZLY-UHFFFAOYSA-N
SMILES:IC=1C=2C(NC1)=CC(Cl)=CC2
Synonyms:- 1-Boc-6-chloro-3-iodo-1H-indole
- 1H-Indole, 6-chloro-3-iodo-
- 6-chloro-3-iodo-1H-indole
- TERT-BUTYL 6-CHLORO-3-IODO-1H-INDOLE-1-CARBOXYLATE
- PCPATSPUGNLZLY-UHFFFAOYSA-N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

