CAS 868702-20-9

1-(4-Hydroxy-2-methoxy-5-methylphenyl)ethanone

Description:

1-(4-Hydroxy-2-methoxy-5-methylphenyl)ethanone, also known by its CAS number 868702-20-9, is an organic compound characterized by its phenolic structure. This substance features a ketone functional group (ethanone) attached to a substituted phenyl ring, which includes hydroxyl (-OH), methoxy (-OCH3), and methyl (-CH3) groups. The presence of these substituents contributes to its potential biological activity, making it of interest in various fields, including medicinal chemistry and pharmacology. The hydroxyl group enhances its solubility in polar solvents, while the methoxy and methyl groups can influence its electronic properties and reactivity. This compound may exhibit antioxidant properties and could be investigated for its role in various biochemical pathways. Its synthesis typically involves the functionalization of aromatic compounds, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, 1-(4-Hydroxy-2-methoxy-5-methylphenyl)ethanone represents a versatile molecule with potential applications in research and industry.

Formula: C₁₀H₁₂O₃

InChI: InChI=1S/C10H12O3/c1-6-4-8(7(2)11)10(13-3)5-9(6)12/h4-5,12H,1-3H3