CAS 86873-60-1
:5-Chloropyridine-2-carboxylic acid
Description:
5-Chloropyridine-2-carboxylic acid is an organic compound characterized by its pyridine ring, which is substituted at the 5-position with a chlorine atom and at the 2-position with a carboxylic acid group. This compound typically appears as a solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid functional group. It exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The chlorine substituent can influence the compound's reactivity and polarity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 5-Chloropyridine-2-carboxylic acid can serve as an intermediate in the synthesis of more complex molecules. Its molecular structure contributes to its potential biological activity, making it a subject of interest in medicinal chemistry research. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H4ClNO2
InChI:InChI=1/C6H4ClNO2/c7-4-1-2-5(6(9)10)8-3-4/h1-3H,(H,9,10)
SMILES:c1cc(C(=O)O)ncc1Cl
Synonyms:- 2-Pyridinecarboxylic acid, 5-chloro-
- 5-Chloropicolinic Acid
- 5-Chloro-2-pyridinecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Chloro-2-pyridinecarboxylic Acid
CAS:Formula:C6H4ClNO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:157.555-Chloropyridine-2-carboxylic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H4ClNO2Purity:95%Color and Shape:Powder, White to pale creamMolecular weight:157.555-Chloro-2-picolinic acid
CAS:Formula:C6H4ClNO2Purity:97%Color and Shape:SolidMolecular weight:157.55455-Chloropyridine-2-carboxylic acid
CAS:5-Chloropyridine-2-carboxylic acidFormula:C6H4ClNO2Purity:98%Color and Shape: white solidMolecular weight:157.55g/mol5-Chloro-2-pyridinecarboxylic acid
CAS:Formula:C6H4ClNO2Purity:≥ 98.0%Color and Shape:White to off-white powder or solidMolecular weight:157.565-Chloropyridine-2-carboxylic acid
CAS:Formula:C6H4ClNO2Purity:97%Color and Shape:SolidMolecular weight:157.55





