
CAS 86873-61-2
:5-(Hydroxyamino)-2-pyridinecarboxylic acid
Description:
5-(Hydroxyamino)-2-pyridinecarboxylic acid, also known by its CAS number 86873-61-2, is an organic compound characterized by the presence of a pyridine ring substituted with both a hydroxylamino group and a carboxylic acid group. This compound typically exhibits properties associated with both amino acids and aromatic compounds, including potential solubility in polar solvents due to the presence of the hydroxyl and carboxylic acid functional groups. The hydroxylamino group can participate in hydrogen bonding, which may influence its reactivity and interactions with other molecules. Additionally, the carboxylic acid group can donate protons, making the compound acidic in nature. Its structure suggests potential applications in pharmaceuticals, biochemistry, and as a building block in organic synthesis. The compound's reactivity may also be influenced by the electronic effects of the pyridine ring, which can stabilize or destabilize certain intermediates during chemical reactions. Overall, 5-(Hydroxyamino)-2-pyridinecarboxylic acid is a versatile compound with interesting chemical properties.
Formula:C6H6N2O3
InChI:InChI=1S/C6H6N2O3/c9-6(10)5-2-1-4(8-11)3-7-5/h1-3,8,11H,(H,9,10)
InChI key:InChIKey=UZGMYUMCCUDIQG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(NO)C=N1
Synonyms:- 2-Pyridinecarboxylic acid, 5-(hydroxyamino)-
- 5-(Hydroxyamino)-2-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.