CymitQuimica logo

CAS 868733-96-4

:

2-Boc-Amino-3-iodo-4-chloropyridine

Description:
2-Boc-Amino-3-iodo-4-chloropyridine is a chemical compound characterized by its pyridine ring, which is substituted with both iodine and chlorine atoms, as well as a tert-butyloxycarbonyl (Boc) protecting group on the amino functional group. The presence of the iodine and chlorine substituents contributes to its reactivity and potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The Boc group serves as a protective moiety for the amino group, allowing for selective reactions without interfering with the amine functionality. This compound is typically used in various synthetic pathways, including coupling reactions and as an intermediate in the synthesis of more complex molecules. Its unique combination of halogen substituents and the Boc protection makes it a valuable building block in medicinal chemistry. As with many halogenated compounds, it is important to handle 2-Boc-Amino-3-iodo-4-chloropyridine with care, considering potential hazards associated with its reactivity and the presence of halogens.
Formula:C10H12ClIN2O2
InChI:InChI=1S/C10H12ClIN2O2/c1-10(2,3)16-9(15)14-8-7(12)6(11)4-5-13-8/h4-5H,1-3H3,(H,13,14,15)
InChI key:ZLCXGKTUUXLBNT-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1=NC=CC(=C1I)Cl
Synonyms:
  • Carbamicacid,N-(4-chloro-3-iodo-2-pyridinyl)-,1,1-dimethylethylester
Found 4 products.