CAS 868754-41-0
:ethyl 2-carbamoylsulfanyl-3-[4-[2-(5-ethyl-2-pyridyl)ethoxy]phenyl]propanoate
Description:
Ethyl 2-carbamoylsulfanyl-3-[4-[2-(5-ethyl-2-pyridyl)ethoxy]phenyl]propanoate, identified by its CAS number 868754-41-0, is a complex organic compound characterized by its unique functional groups and structural features. This substance contains an ethyl ester group, a carbamoyl group, and a sulfanyl moiety, which contribute to its chemical reactivity and potential biological activity. The presence of a pyridine ring suggests possible interactions with biological systems, as pyridine derivatives are often associated with pharmacological properties. Additionally, the compound features a propanoate backbone, which may influence its solubility and stability. Its intricate structure indicates that it may exhibit specific properties such as lipophilicity, which can affect its absorption and distribution in biological contexts. Overall, this compound's characteristics suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents, although further studies would be necessary to fully elucidate its properties and biological effects.
Formula:C21H26N2O4S
InChI:InChI=1/C21H26N2O4S/c1-3-15-5-8-17(23-14-15)11-12-27-18-9-6-16(7-10-18)13-19(28-21(22)25)20(24)26-4-2/h5-10,14,19H,3-4,11-13H2,1-2H3,(H2,22,25)
SMILES:CCc1ccc(CCOc2ccc(cc2)CC(C(=O)OCC)SC(=N)O)nc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Pioglitazone EP Impurity D
CAS:Formula:C21H26N2O4SColor and Shape:White To Off-White SolidMolecular weight:402.51

