CAS 868755-53-7

6-morpholin-4-ylpyridine-2-carbonitrile

Description:

6-Morpholin-4-ylpyridine-2-carbonitrile is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a morpholine group and a cyano (nitrile) functional group. This compound typically exhibits properties such as moderate solubility in polar organic solvents and may have limited solubility in water due to its hydrophobic pyridine and morpholine components. The presence of the cyano group contributes to its potential reactivity, making it a candidate for various chemical reactions, including nucleophilic additions and substitutions. Additionally, the morpholine moiety can influence the compound's biological activity, potentially making it relevant in pharmaceutical applications. The compound's molecular structure allows for interactions with biological targets, which may lead to various pharmacological effects. Overall, 6-morpholin-4-ylpyridine-2-carbonitrile is of interest in medicinal chemistry and may serve as a scaffold for the development of new therapeutic agents.

Formula: C₁₀H₁₁N₃O

InChI: InChI=1/C10H11N3O/c11-8-9-2-1-3-10(12-9)13-4-6-14-7-5-13/h1-3H,4-7H2

SMILES: c1cc(C#N)nc(c1)N1CCOCC1

6-(Morpholin-4-yl)pyridine-2-carbonitrile

CAS: 868755-53-7

Formula: C₁₀H₁₁N₃O

Color and Shape: Solid

Molecular weight: 189.2138

Ref: IN-DA004IC8

6-(Morpholin-4-yl)pyridine-2-carbonitrile

CAS: 868755-53-7

6-(Morpholin-4-yl)pyridine-2-carbonitrile

Purity: 98%

Molecular weight: 189.21g/mol

Ref: 54-OR959809

6-(Morpholin-4-yl)pyridine-2-carbonitrile

CAS: 868755-53-7

Versatile small molecule scaffold

Formula: C₁₀H₁₁N₃O

Purity: Min. 95%

Molecular weight: 189.22 g/mol

Ref: 3D-TJB75553