CAS 868771-19-1

2-Chloro-N-(3-chloro-4-fluorophenyl)propanamide

Description:

2-Chloro-N-(3-chloro-4-fluorophenyl)propanamide is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. The presence of chlorine and fluorine substituents on the aromatic ring contributes to its unique chemical properties and potential biological activity. This compound features a chloro group at the second position of the propanamide chain and a substituted phenyl group that includes both a chlorine atom at the meta position and a fluorine atom at the para position. Such substitutions can influence the compound's lipophilicity, reactivity, and interaction with biological targets. The molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific therapeutic effects. Additionally, the presence of halogens often enhances the compound's stability and can affect its solubility in various solvents. As with many halogenated compounds, safety considerations regarding toxicity and environmental impact should be taken into account during handling and application.

Formula: C₉H₈Cl₂FNO

InChI: InChI=1S/C9H8Cl2FNO/c1-5(10)9(14)13-6-2-3-8(12)7(11)4-6/h2-5H,1H3,(H,13,14)

InChI key: InChIKey=YVPGRZXOVIMESQ-UHFFFAOYSA-N

SMILES: N(C(C(C)Cl)=O)C1=CC(Cl)=C(F)C=C1

Synonyms:

• 2-Chloro-N-(3-chloro-4-fluorophenyl)propanamide
• Propanamide, 2-chloro-N-(3-chloro-4-fluorophenyl)-
• 2-Chloro-N-(3-chloro-4-fluoro-phenyl)-propionamide