CAS 86879-39-2
:3-Carboxy-4-methyl-5-propyl-2-furanpropanoic acid
Description:
3-Carboxy-4-methyl-5-propyl-2-furanpropanoic acid, identified by its CAS number 86879-39-2, is an organic compound characterized by a furan ring structure that incorporates a carboxylic acid functional group. This compound features a propanoic acid moiety attached to a furan, which contributes to its unique chemical properties. The presence of the carboxylic acid group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and neutralization. The methyl and propyl substituents on the furan ring influence its solubility and reactivity, potentially enhancing its lipophilicity. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. As with many organic acids, it is likely to be soluble in polar solvents and may exhibit varying degrees of stability under different environmental conditions.
Formula:C12H16O5
InChI:InChI=1S/C12H16O5/c1-3-4-8-7(2)11(12(15)16)9(17-8)5-6-10(13)14/h3-6H2,1-2H3,(H,13,14)(H,15,16)
InChI key:InChIKey=WMCQWXZMVIETAO-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1=C(C(O)=O)C(C)=C(CCC)O1
Synonyms:- 2-Furanpropanoic Acid, 3-Carboxy-4-Methyl-5-Propyl-
- 3-Carboxy-4-Methyl-5-Propyl-2-Furanpropanoic Acid
- 3-Carboxy-4-methyl-5-propyl-2-furanpropionic acid
- Propylurofuranic acid
- CMPF
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-carboxy-4-methyl-5-propyl-2-furanpropanoic acid
CAS:Formula:C12H16O5Purity:>98%Color and Shape:SolidMolecular weight:240.25CMPF
CAS:Controlled ProductApplications CMPF is a drug-binding inhibitor which is also a constituent of urine. CMPF can inhibit specific T4 binding in serum by increasing the free concentration of direct competitors.
References Mabuchi, H., Nakahashi, H.: Nephron, 44, 277 (1986); Lim, C.F., et. al.: Metabolism Clin. Exp., 42, 1468 (1993);Formula:C12H16O5Color and Shape:NeatMolecular weight:240.25CMPF-d3 (Major)
CAS:Controlled ProductApplications CMPF-d3 is the labeled analogue of CMPF (C595000). CMPF is a drug-binding inhibitor which is also a constituent of urine. CMPF can inhibit specific T4 binding in serum by increasing the free concentration of direct competitors.
References Mabuchi, H., Nakahashi, H.: Nephron, 44, 277 (1986); Lim, C.F., et. al.: Metabolism Clin. Exp., 42, 1468 (1993);Formula:C12D5H11O5Color and Shape:NeatMolecular weight:245.28CMPF
CAS:CMPF is a microtubule protein inhibitor that can be used to study tumors.Formula:C12H16O5Purity:99.88%Color and Shape:SolidMolecular weight:240.25Ref: TM-T68490
1mg66.00€5mg172.00€10mg250.00€25mg425.00€50mg610.00€100mg853.00€200mg1,144.00€500µg46.00€




