CAS 86891-09-0

Ergoline-8-carboxylic acid, methyl ester, (8α)-

Description:

Ergoline-8-carboxylic acid, methyl ester, (8α)-, with the CAS number 86891-09-0, is a chemical compound belonging to the ergoline family, which is characterized by a tetracyclic structure derived from the indole alkaloids. This compound features a carboxylic acid functional group esterified with a methyl group, contributing to its solubility and reactivity. Ergoline derivatives are known for their diverse biological activities, including effects on the central nervous system, which can be attributed to their structural similarity to neurotransmitters. The specific stereochemistry at the 8α position influences its pharmacological properties and interactions with biological targets. In terms of physical properties, ergoline derivatives typically exhibit moderate to low solubility in water but may be more soluble in organic solvents. The compound's potential applications span various fields, including pharmaceuticals and biochemistry, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. As with many ergoline derivatives, safety and handling precautions are essential due to potential biological activity.

Formula: C₁₆H₁₈N₂O₂

InChI: InChI=1S/C16H18N2O2/c1-20-16(19)10-5-12-11-3-2-4-13-15(11)9(7-17-13)6-14(12)18-8-10/h2-4,7,10,12,14,17-18H,5-6,8H2,1H3/t10-,12+,14+/m0/s1

InChI key: InChIKey=ORIBUSCBDFDAIQ-ZKYQVNSYSA-N

SMILES: C(OC)(=O)[C@H]1C[C@@]2(C=3C=4C(C[C@]2(NC1)[H])=CNC4C=CC3)[H]

Synonyms:

• 9,10-Dihydro-6-demethylisolysergic acid methyl ester
• Methyl dihydronorisolysergate
• Indolo[4,3-fg]quinoline, ergoline-8-carboxylic acid deriv.
• Ergoline-8-carboxylic acid, methyl ester, (8α)-

Ergotamine Impurity 6

CAS: 86891-09-0

Formula: C₁₆H₁₈N₂O₂

Molecular weight: 270.33

Ref: 4Z-E-6127