CAS 868948-11-2
:Propanamide, N-(6-chloro-3-pyridazinyl)-
Description:
Propanamide, N-(6-chloro-3-pyridazinyl)-, identified by its CAS number 868948-11-2, is a chemical compound characterized by the presence of a propanamide functional group and a pyridazine ring substituted with a chlorine atom. This compound typically exhibits properties associated with amides, such as being polar and capable of forming hydrogen bonds, which can influence its solubility in polar solvents. The presence of the chloro substituent on the pyridazine ring may impart unique reactivity and biological activity, making it of interest in pharmaceutical research. Compounds like this can be involved in various applications, including medicinal chemistry, where they may serve as potential drug candidates or intermediates in the synthesis of more complex molecules. The specific structural features, including the position of the chloro group and the nature of the substituents, can significantly affect the compound's physical and chemical properties, such as melting point, boiling point, and reactivity.
Formula:C7H8ClN3O
InChI:InChI=1/C7H8ClN3O/c1-2-7(12)9-6-4-3-5(8)10-11-6/h3-4H,2H2,1H3,(H,9,11,12)
SMILES:CCC(=O)N=c1ccc(Cl)n[nH]1
Synonyms:- N-(6-Chloro-3-pyridazinyl)propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.