CymitQuimica logo

CAS 868948-12-3

:

Butanamide, N-(6-chloro-3-pyridazinyl)-

Description:
Butanamide, N-(6-chloro-3-pyridazinyl)- is a chemical compound characterized by its amide functional group, which is derived from butanoic acid. The presence of a pyridazine ring, specifically substituted with a chlorine atom at the 6-position, contributes to its unique chemical properties. This compound typically exhibits moderate polarity due to the amide group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The chlorinated pyridazine moiety may impart specific biological activity or reactivity, making it of interest in pharmaceutical research. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the chlorine substituent and the overall steric environment of the molecule. As with many amides, it may also exhibit characteristics such as moderate melting and boiling points, depending on its molecular interactions. Overall, Butanamide, N-(6-chloro-3-pyridazinyl)- represents a compound with potential utility in various chemical and biological applications.
Formula:C8H10ClN3O
InChI:InChI=1/C8H10ClN3O/c1-2-3-8(13)10-7-5-4-6(9)11-12-7/h4-5H,2-3H2,1H3,(H,10,12,13)
SMILES:CCCC(=O)N=c1ccc(Cl)n[nH]1
Synonyms:
  • N-(6-Chloro-3-pyridazinyl)butanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.