CymitQuimica logo

CAS 868948-13-4

:

Pentanamide, N-(6-chloro-3-pyridazinyl)-

Description:
Pentanamide, N-(6-chloro-3-pyridazinyl)- is a chemical compound characterized by its amide functional group and a pyridazine ring substituted with a chlorine atom. The presence of the pentanamide structure indicates that it has a five-carbon alkyl chain attached to the nitrogen of the amide group. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and the ability to participate in hydrogen bonding due to the amide group. The chlorinated pyridazine moiety may impart specific biological activity or reactivity, making it of interest in pharmaceutical or agrochemical applications. Additionally, the compound's molecular structure suggests potential for interactions with biological targets, which could be explored in drug development. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as temperature and pH. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.
Formula:C9H12ClN3O
InChI:InChI=1/C9H12ClN3O/c1-2-3-4-9(14)11-8-6-5-7(10)12-13-8/h5-6H,2-4H2,1H3,(H,11,13,14)
SMILES:CCCCC(=O)N=c1ccc(Cl)n[nH]1
Synonyms:
  • N-(6-Chloro-3-pyridazinyl)pentanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.