CAS 868948-14-5
:Hexanamide, N-(6-chloro-3-pyridazinyl)-
Description:
Hexanamide, N-(6-chloro-3-pyridazinyl)- is an organic compound characterized by its amide functional group and a pyridazine ring substituted with a chlorine atom. The presence of the hexanamide structure indicates that it has a six-carbon alkyl chain attached to the nitrogen atom of the amide group. This compound is likely to exhibit moderate polarity due to the amide functional group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The chlorinated pyridazine moiety may impart specific biological activity or reactivity, making it of interest in pharmaceutical or agrochemical applications. Additionally, the compound's molecular structure suggests potential for various interactions, including hydrogen bonding and dipole-dipole interactions, which can affect its physical properties such as melting point, boiling point, and solubility. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose health risks.
Formula:C10H14ClN3O
InChI:InChI=1/C10H14ClN3O/c1-2-3-4-5-10(15)12-9-7-6-8(11)13-14-9/h6-7H,2-5H2,1H3,(H,12,14,15)
SMILES:CCCCCC(=O)N=c1ccc(Cl)n[nH]1
Synonyms:- N-(6-Chloro-3-pyridazinyl)hexanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.