CAS 868963-99-9
:2,3-Dihydro-1-(1-oxopropyl)-1H-indole-5-sulfonyl chloride
Description:
2,3-Dihydro-1-(1-oxopropyl)-1H-indole-5-sulfonyl chloride is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a sulfonyl chloride functional group, which is known for its reactivity, particularly in nucleophilic substitution reactions. The presence of the 1-oxopropyl group indicates that it has a ketone functionality, contributing to its potential reactivity and applications in organic synthesis. The sulfonyl chloride moiety enhances its utility in the formation of sulfonamides and other derivatives. This compound is typically used in research and development, particularly in medicinal chemistry, due to its potential biological activity. It is important to handle this substance with care, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or amines. Proper safety protocols should be followed when working with this compound in laboratory settings.
Formula:C11H12ClNO3S
InChI:InChI=1S/C11H12ClNO3S/c1-2-11(14)13-6-5-8-7-9(17(12,15)16)3-4-10(8)13/h3-4,7H,2,5-6H2,1H3
InChI key:InChIKey=WRGDULRLERROFA-UHFFFAOYSA-N
SMILES:C(CC)(=O)N1C=2C(=CC(S(Cl)(=O)=O)=CC2)CC1
Synonyms:- 1-Propionyl-2,3-dihydro-1H-indole-5-sulfonyl chloride
- 1-Propanoyl-2,3-dihydro-1H-indole-5-sulfonyl chloride
- 1H-Indole-5-sulfonyl chloride, 2,3-dihydro-1-(1-oxopropyl)-
- 2,3-Dihydro-1-(1-oxopropyl)-1H-indole-5-sulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.