CAS 868997-85-7

2-Butoxy-3-iodo-4-pyridinamine

Description:

2-Butoxy-3-iodo-4-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a butoxy group indicates that there is a butyl chain attached via an ether linkage, contributing to its hydrophobic properties. The iodo substituent at the 3-position of the pyridine ring enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The amino group at the 4-position introduces basicity and potential for hydrogen bonding, which can influence its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, making it relevant in medicinal chemistry. Its molecular structure suggests it could participate in various chemical reactions, including those typical of halogenated compounds and amines. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of iodine, which can be hazardous.

Formula: C₉H₁₃IN₂O

InChI: InChI=1S/C9H13IN2O/c1-2-3-6-13-9-8(10)7(11)4-5-12-9/h4-5H,2-3,6H2,1H3,(H2,11,12)

InChI key: InChIKey=OKIQTIPKENIQNE-UHFFFAOYSA-N

SMILES: O(CCCC)C1=C(I)C(N)=CC=N1

Synonyms:

• 2-Butoxy-3-iodo-4-aminopyridine
• 4-Pyridinamine, 2-butoxy-3-iodo-
• 2-Butoxy-3-iodopyridin-4-amine
• 2-Butoxy-3-iodo-4-pyridinamine

2-Butoxy-3-iodopyridin-4-amine

CAS: 868997-85-7

Formula: C₉H₁₃IN₂O

Molecular weight: 292.1168

Ref: IN-DA00H3OI