CAS 869-00-1
:(2E)-2-cyanohex-2-enoic acid
Description:
(2E)-2-cyanohex-2-enoic acid, with the CAS number 869-00-1, is an organic compound characterized by its unique structure that includes a cyano group (-CN) and a double bond in the alkene configuration. This compound features a six-carbon chain with a carboxylic acid functional group (-COOH) and a cyano group attached to the second carbon of the chain. The presence of the double bond in the trans configuration (indicated by "2E") contributes to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The compound is soluble in polar solvents, which enhances its utility in various chemical reactions. Its reactivity is influenced by both the cyano and carboxylic acid groups, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C7H9NO2
InChI:InChI=1/C7H9NO2/c1-2-3-4-6(5-8)7(9)10/h4H,2-3H2,1H3,(H,9,10)/b6-4+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.