CAS 869-06-7
:Magnesium malate
Description:
Magnesium malate is a chemical compound formed from magnesium and malic acid, which is an organic compound found in various fruits. It is represented by the formula C4H4MgO5 and is known for its role as a dietary supplement. Magnesium malate is characterized by its white crystalline appearance and is soluble in water, making it bioavailable for absorption in the body. This compound is often used to support energy production, muscle function, and overall metabolic health, as malic acid plays a crucial role in the Krebs cycle, a key energy-producing process in cells. Additionally, magnesium is essential for numerous biochemical reactions, including those involved in nerve function and muscle contraction. Magnesium malate is generally considered safe for consumption, although individuals should consult healthcare professionals before starting any supplementation, especially those with underlying health conditions or those taking medications. Its potential benefits, combined with its mineral content, make it a popular choice among those seeking to enhance their nutritional intake.
Formula:C4H6O5·Mg
InChI:InChI=1S/C4H6O5.Mg/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);
InChI key:InChIKey=SLSSJIXQBCBABG-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(C(O)=O)O.[Mg]
Synonyms:- Butanedioic acid, hydroxy-, magnesium salt (1:1)
- Malic acid magnesium salt (1:1)
- magnesium 2-hydroxybutanedioate
- Butanedioic acid, 2-hydroxy-, magnesium salt (1:1)
- Magnesium malate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Magnesium malate hydrate
CAS:Please enquire for more information about Magnesium malate hydrate including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C4H6O5•Mg•(H2O)xPurity:Min. 95%Color and Shape:PowderMolecular weight:156.38 g/molMagnesium Malate
CAS:Please enquire for more information about Magnesium Malate including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C4H4MgO5Purity:Min. 95%Molecular weight:156.38 g/mol
