CAS 869-74-9
:4-(Methylamino)pent-3-en-2-one
Description:
4-(Methylamino)pent-3-en-2-one, also known by its CAS number 869-74-9, is an organic compound characterized by its structure, which includes a methylamino group and a conjugated enone system. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It possesses a distinctive odor and is soluble in polar organic solvents. The presence of the methylamino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The enone functionality contributes to its reactivity, making it a potential intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, 4-(Methylamino)pent-3-en-2-one may exhibit biological activity, which warrants careful handling and consideration of safety protocols due to potential toxicity. Overall, its unique structural features and reactivity make it a compound of interest in both academic and industrial chemistry contexts.
Formula:C6H11NO
InChI:InChI=1/C6H11NO/c1-5(7-3)4-6(2)8/h4,7H,1-3H3
SMILES:CC(=CC(=O)C)NC
Synonyms:- (3E)-4-(Methylamino)-3-penten-2-one
- (3E)-4-(Methylamino)pent-3-en-2-one
- 3-penten-2-one, 4-(methylamino)-, (3E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
