CAS 869109-14-8

4-[[4-(Trifluoromethyl)-2-pyridinyl]oxy]benzoic acid

Description:

4-[[4-(Trifluoromethyl)-2-pyridinyl]oxy]benzoic acid, identified by its CAS number 869109-14-8, is a chemical compound characterized by its complex structure that includes a benzoic acid moiety and a pyridine ring substituted with a trifluoromethyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The compound's functional groups suggest potential applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals. Additionally, its structural features may confer specific reactivity patterns, making it suitable for various synthetic transformations. Overall, 4-[[4-(Trifluoromethyl)-2-pyridinyl]oxy]benzoic acid represents a versatile building block in organic synthesis and materials science.

Formula: C₁₃H₈F₃NO₃

InChI: InChI=1S/C13H8F3NO3/c14-13(15,16)9-5-6-17-11(7-9)20-10-3-1-8(2-4-10)12(18)19/h1-7H,(H,18,19)

InChI key: InChIKey=HFJHPBHICQXUBD-UHFFFAOYSA-N

SMILES: O(C1=CC(C(F)(F)F)=CC=N1)C2=CC=C(C(O)=O)C=C2

Synonyms:

• 4-[[4-(Trifluoromethyl)-2-pyridinyl]oxy]benzoic acid
• Benzoic acid, 4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]-