CymitQuimica logo

CAS 86912-84-7

:

1-(3-Chlorophenoxy)-3-butyn-2-ol

Description:
1-(3-Chlorophenoxy)-3-butyn-2-ol, with the CAS number 86912-84-7, is an organic compound characterized by its unique structure, which includes a phenoxy group and a butynol moiety. This compound features a chlorinated aromatic ring, specifically a 3-chlorophenyl group, which contributes to its chemical reactivity and potential biological activity. The presence of the butynol functional group indicates that it has an alkyne and an alcohol functional group, which can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The compound is typically a colorless to pale yellow liquid, and its solubility can vary depending on the solvent used, often being more soluble in organic solvents than in water. Its properties make it of interest in fields such as medicinal chemistry and agrochemicals, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as chlorinated compounds can pose environmental and health risks.
Formula:C10H9ClO2
InChI:InChI=1/C10H9ClO2/c1-2-9(12)7-13-10-5-3-4-8(11)6-10/h1,3-6,9,12H,7H2
SMILES:C#CC(COc1cccc(c1)Cl)O
Synonyms:
  • 1-(3-Chlorophenoxy)But-3-Yn-2-Ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.