CAS 86921-26-8

Hexafluorophosphoric acid

Description:

Hexafluorophosphoric acid, with the CAS number 86921-26-8, is a strong inorganic acid characterized by its high acidity and the presence of six fluorine atoms bonded to a phosphorus atom. It is typically encountered as a colorless, fuming liquid that is highly corrosive and can release toxic fumes upon contact with moisture. This acid is known for its ability to act as a strong proton donor, making it useful in various chemical reactions, particularly in the synthesis of fluorinated compounds and as a catalyst in organic chemistry. Hexafluorophosphoric acid is also notable for its stability and non-hygroscopic nature, which allows it to be stored without significant degradation. However, due to its corrosive properties, it requires careful handling and storage in appropriate materials, such as glass or certain plastics, to prevent reactions with metals or organic substances. Its applications extend to the production of ionic liquids and as a reagent in the preparation of phosphonium salts.

Formula: F₆P·H

InChI: InChI=1S/F6P/c1-7(2,3,4,5)6/q-1/p+1

InChI key: InChIKey=LJQLCJWAZJINEB-UHFFFAOYSA-O

SMILES: [P+5]([F-])([F-])([F-])([F-])([F-])[F-].[H+]

Synonyms:

• Phosphate(1-), hexafluoro-, hydrogen
• Hydrogen hexafluorophosphate
• Phosphate(1-), hexafluoro-, hydrogen (1:1)
• Hydrogen hexafluorophosphate(1-)
• Hexafluorophosphoric acid

SodiuM Borotritide

CAS: 86921-26-8

Ref: IN-DA00H391