CAS 869222-69-5

Uridine, 2′-deoxy-5-[(1E)-3-oxo-3-[[2-[(trifluoroacetyl)amino]ethyl]amino]-1-propenyl]-

Description:

Uridine, 2′-deoxy-5-[(1E)-3-oxo-3-[[2-[(trifluoroacetyl)amino]ethyl]amino]-1-propenyl]- is a synthetic nucleoside derivative characterized by its unique structural features, which include a uridine backbone modified with a propenyl side chain and a trifluoroacetyl group. This compound is part of a class of molecules that can exhibit biological activity, potentially influencing nucleic acid metabolism or serving as a precursor in various biochemical pathways. The presence of the trifluoroacetyl group may enhance lipophilicity and stability, which can affect its pharmacokinetic properties. Additionally, the propenyl moiety may participate in various chemical reactions, making it a candidate for further functionalization or use in medicinal chemistry. As with many nucleoside analogs, this compound could be of interest in the development of antiviral or anticancer therapies, although specific biological activities would need to be evaluated through experimental studies. Overall, its unique structure suggests potential utility in biochemical research and therapeutic applications.

Formula: C₁₆H₁₉F₃N₄O₇

InChI: InChI=1S/C16H19F3N4O7/c17-16(18,19)14(28)21-4-3-20-11(26)2-1-8-6-23(15(29)22-13(8)27)12-5-9(25)10(7-24)30-12/h1-2,6,9-10,12,24-25H,3-5,7H2,(H,20,26)(H,21,28)(H,22,27,29)/b2-1+/t9-,10+,12+/m0/s1

InChI key: InChIKey=YOHIJANZSAVOSL-QUAUNDHZSA-N

SMILES: O=C1N([C@@H]2O[C@H](CO)[C@@H](O)C2)C=C(/C=C/C(NCCNC(C(F)(F)F)=O)=O)C(=O)N1

Synonyms:

• Uridine, 2′-deoxy-5-[(1E)-3-oxo-3-[[2-[(trifluoroacetyl)amino]ethyl]amino]-1-propenyl]-

5-[N(2-Trifluoroacetamido)ethyl)-3-(E)-acrylamido]-2-deoxyuridine

CAS: 869222-69-5

5-[N(2-Trifluoroacetamido)ethyl)-3-(E)-acrylamido]-2-deoxyuridine is an anticancer, antiviral, and phosphoramidite DNA synthesis reagent that is modified by the addition of a trifluoroacetamide group. It has been shown to activate monophosphate nucleotides and nucleosides to their corresponding diphosphates and deoxyribonucleosides. 5-[N(2-Trifluoroacetamido)ethyl]-3-(E)-acrylamido]-2-deoxyuridine is synthesized from 2-deoxyuridine which is derived from uracil and phenol. This novel chemical substance has shown promising results in preclinical testing against human cancers and viral infections.

Formula: C₁₆H₁₉F₃N₄O₇

Purity: Min. 95%

Molecular weight: 436.34 g/mol

Ref: 3D-UJB22269