CymitQuimica logo

CAS 869296-21-9

:

ethyl 4-oxo-3H-pyrido[3,4-d]pyrimidine-2-carboxylate

Description:
Ethyl 4-oxo-3H-pyrido[3,4-d]pyrimidine-2-carboxylate is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the 4-oxo group indicates a ketone functionality, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Ethyl 4-oxo-3H-pyrido[3,4-d]pyrimidine-2-carboxylate is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure suggests potential biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. The compound's CAS number, 869296-21-9, allows for easy identification and retrieval of information in chemical databases. Overall, this compound exemplifies the diverse chemistry of nitrogen-containing heterocycles and their utility in various chemical and pharmaceutical applications.
Formula:C10H9N3O3
InChI:InChI=1/C10H9N3O3/c1-2-16-10(15)8-12-7-5-11-4-3-6(7)9(14)13-8/h3-5H,2H2,1H3,(H,12,13,14)
SMILES:CCOC(=O)c1[nH]c2cnccc2c(=O)n1
Synonyms:
  • Ethyl 4-oxo-3,4-dihydropyrido[3,4-d]pyrimidine-2-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.