CAS 869299-34-3
:2-[(3-Methoxypropyl)amino]-4-pyridinecarbonitrile
Description:
2-[(3-Methoxypropyl)amino]-4-pyridinecarbonitrile, identified by its CAS number 869299-34-3, is a chemical compound characterized by its pyridine ring structure, which is substituted with a cyano group and an amino group linked to a 3-methoxypropyl chain. This compound typically exhibits properties associated with both polar and non-polar characteristics due to the presence of the methoxy group and the cyano functionality. It is likely to be soluble in polar solvents, while its hydrophobic alkyl chain may impart some degree of lipophilicity. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with various biological pathways. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c1-14-6-2-4-12-10-7-9(8-11)3-5-13-10/h3,5,7H,2,4,6H2,1H3,(H,12,13)
InChI key:InChIKey=HOSVHKWOPXEEPD-UHFFFAOYSA-N
SMILES:N(CCCOC)C1=CC(C#N)=CC=N1
Synonyms:- 2-[[3-(Methyloxy)propyl]amino]pyridine-4-carbonitrile
- 2-[(3-Methoxypropyl)amino]-4-pyridinecarbonitrile
- 4-Pyridinecarbonitrile, 2-[(3-methoxypropyl)amino]-
- 2-((3-Methoxypropyl)amino)isonicotinonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
