
CAS 869299-44-5
:2-Quinazolinecarboxylic acid, 4-methoxy-, methyl ester
Description:
2-Quinazolinecarboxylic acid, 4-methoxy-, methyl ester, identified by CAS number 869299-44-5, is an organic compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features a carboxylic acid functional group that is esterified with methanol, resulting in a methyl ester. The presence of a methoxy group at the 4-position of the quinazoline ring contributes to its chemical properties, potentially influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential interactions with biological targets, and the compound may be investigated for its pharmacological properties. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including esterification and possibly cyclization reactions. Overall, this compound represents a specific class of heterocyclic compounds with diverse applications in research and industry.
Formula:C11H10N2O3
InChI:InChI=1S/C11H10N2O3/c1-15-10-7-5-3-4-6-8(7)12-9(13-10)11(14)16-2/h3-6H,1-2H3
InChI key:InChIKey=ZOBKTVLTAAGKKA-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(N=C(C(OC)=O)N1)C=CC=C2
Synonyms:- 2-Quinazolinecarboxylic acid, 4-methoxy-, methyl ester
- Methyl 4-methoxyquinazoline-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.