CAS 86933-75-7
:Neurokinin B
Description:
Neurokinin B (NKB) is a neuropeptide that plays a significant role in various physiological processes, particularly in the central nervous system and reproductive functions. It is a member of the tachykinin family of peptides, which are characterized by their ability to bind to neurokinin receptors, specifically NK3 receptors. NKB is involved in the regulation of pain, inflammation, and neurogenic responses, as well as influencing reproductive hormone release and circadian rhythms. The chemical structure of Neurokinin B consists of a sequence of amino acids, typically including a C-terminal end that is crucial for receptor binding and activity. Its biological functions are mediated through signaling pathways that affect neuronal excitability and neurotransmitter release. NKB has garnered interest in research related to conditions such as anxiety, depression, and reproductive disorders, making it a potential target for therapeutic interventions. The CAS number 86933-75-7 uniquely identifies this peptide in chemical databases, facilitating its study and application in biomedical research.
Formula:C55H79N13O14S2
InChI:InChI=1/C55H79N13O14S2/c1-30(2)21-38(50(77)62-36(47(57)74)17-19-83-5)61-43(69)28-59-55(82)46(31(3)4)68-54(81)40(23-33-15-11-8-12-16-33)65-51(78)39(22-32-13-9-7-10-14-32)64-53(80)42(26-45(72)73)67-52(79)41(24-34-27-58-29-60-34)66-49(76)37(18-20-84-6)63-48(75)35(56)25-44(70)71/h7-16,27,29-31,35-42,46H,17-26,28,56H2,1-6H3,(H2,57,74)(H,58,60)(H,59,82)(H,61,69)(H,62,77)(H,63,75)(H,64,80)(H,65,78)(H,66,76)(H,67,79)(H,68,81)(H,70,71)(H,72,73)
SMILES:CC(C)CC(C(=NC(CCSC)C(=N)O)O)N=C(CN=C(C(C(C)C)N=C(C(Cc1ccccc1)N=C(C(Cc1ccccc1)N=C(C(CC(=O)O)N=C(C(Cc1cnc[nH]1)N=C(C(CCSC)N=C(C(CC(=O)O)N)O)O)O)O)O)O)O)O
Synonyms:- H-Asp-Met-His-Asp-Phe-Phe-Val-Gly-Leu-Met-NH2
- neuromedin K
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Neurokinin B
CAS:NKB is a tachykinin involved in the production of GnRH and other sexual hormones.Formula:C55H79N13O14S2Purity:98.8%Color and Shape:White LyophilisateMolecular weight:1210.44Neurokinin B
CAS:NKB, a tachykinin peptide, impacts human functions like gonadotropin-releasing hormone secretion.Formula:C55H79N13O14S2Purity:98%Color and Shape:SolidMolecular weight:1210.42Neurokinin B (Human, Porcine, Bovine, Rat, Mouse)
CAS:As a member of the tachykinin neuropeptide family, Neurokinin B is involved in the dilation of blood vessels, the contraction of smooth muscles and the excitation of neurons. This product can be applied as a NK3 receptors selective agonist and is available as a 0.5mg vial.
Formula:C55H79N13O14S2Purity:Min. 95%Molecular weight:1,210.4 g/molNeurokinin B trifluroacetate
CAS:Please enquire for more information about Neurokinin B trifluroacetate including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C55H79N13O14S2•(C2HF3O2)xPurity:Min. 95%Neurokinin B trifluoroacetate salt
CAS:Neurokinin B trifluoroacetate salt H-Asp-Met-His-Asp-Phe-Phe-Val-Gly-Leu-Met-NH2 trifluoroacetate salt is a synthetic peptide that is a potent and selective antagonist of the NMDA receptor. Neurokinin B trifluoroacetate salt H-Asp-Met-His-Asp-Phe-Phe-Val-Gly-Leu-Met NH2 trifluoroacetate salt has been shown to be effective in animal models of chronic pain, neuropathic pain, and bone age delay. This synthetic peptide has also been shown to be effective in the treatment of squamous cell carcinoma and acid lesions in human subjects. The molecular weight of this compound is 624.6 g/mol.br> Neurokinin B trifluoroacetate salt H Asp Met His Asp PFormula:C55H79N13O14S2Purity:Min. 95%Molecular weight:1,210.43 g/mol



