CAS 869335-22-8
:6-Chloro-4-nitro-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-pyrrolo[2,3-b]pyridine
Description:
6-Chloro-4-nitro-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-pyrrolo[2,3-b]pyridine is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrolopyridine core. The presence of a chloro group and a nitro group contributes to its reactivity and potential applications in medicinal chemistry. The trimethylsilyl group enhances its solubility and stability, making it suitable for various chemical reactions and applications. This compound is likely to exhibit biological activity, which may be explored in drug development, particularly in targeting specific biological pathways. Its unique functional groups suggest potential interactions with biological macromolecules, making it a candidate for further research in pharmacology. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by its molecular structure and substituents, which are critical for understanding its behavior in different environments. Overall, this compound represents a valuable entity in the field of organic synthesis and pharmaceutical research.
Formula:C13H18ClN3O3Si
InChI:InChI=1S/C13H18ClN3O3Si/c1-21(2,3)7-6-20-9-16-5-4-10-11(17(18)19)8-12(14)15-13(10)16/h4-5,8H,6-7,9H2,1-3H3
InChI key:InChIKey=RNOMBRWJOMMWLN-UHFFFAOYSA-N
SMILES:C(OCC[Si](C)(C)C)N1C=2C(=C(N(=O)=O)C=C(Cl)N2)C=C1
Synonyms:- 2-[(6-Chloro-4-nitropyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane
- 1H-Pyrrolo[2,3-b]pyridine, 6-chloro-4-nitro-1-[[2-(trimethylsilyl)ethoxy]methyl]-
- 6-Chloro-4-nitro-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 6-chloro-4-nitro-1-[[2-(triMethylsilyl)ethoxy]Methyl]-3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.