CymitQuimica logo

CAS 869335-75-1

:

4-Chloro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine

Description:
4-Chloro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both a pyridine and a pyrrole ring. The presence of a chloro group and a trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially its reactivity. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen substituents that can modulate biological activity. Additionally, the trifluoromethyl group is known to enhance metabolic stability and bioavailability. The compound's synthesis and reactivity can be influenced by the electronic effects of the substituents, making it a subject of interest in various chemical research fields, including agrochemicals and materials science. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C8H4ClF3N2
InChI:InChI=1S/C8H4ClF3N2/c9-5-1-2-13-7-6(5)4(3-14-7)8(10,11)12/h1-3H,(H,13,14)
InChI key:InChIKey=PMQCMQSPOHRVBS-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=2C(NC1)=NC=CC2Cl
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-3-(trifluoromethyl)-
  • 4-Chloro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
Found 4 products.