CymitQuimica logo

CAS 869367-01-1

:

8-Chloro-1-(2-fluoro-6-methoxyphenyl)-3,4-dihydro-5H-2-benzazepin-5-one

Description:
8-Chloro-1-(2-fluoro-6-methoxyphenyl)-3,4-dihydro-5H-2-benzazepin-5-one is a chemical compound characterized by its complex structure, which includes a benzazepine core. This compound features a chloro substituent at the 8-position and a methoxy group at the 6-position of a phenyl ring, along with a fluorine atom at the 2-position of the same ring. The presence of these functional groups suggests potential biological activity, possibly influencing its pharmacological properties. The compound is likely to exhibit moderate lipophilicity due to the aromatic rings and substituents, which can affect its solubility and permeability. Additionally, the benzazepine framework is known for its role in various medicinal chemistry applications, particularly in the development of psychoactive and neuroactive agents. Its specific interactions with biological targets would depend on the precise arrangement of its substituents and the overall three-dimensional conformation. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C17H13ClFNO2
InChI:InChI=1S/C17H13ClFNO2/c1-22-15-4-2-3-13(19)16(15)17-12-9-10(18)5-6-11(12)14(21)7-8-20-17/h2-6,9H,7-8H2,1H3
InChI key:InChIKey=YEQYRJGDOZAGDS-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=2C=3C(=CC=C(Cl)C3)C(=O)CCN2)C(F)=CC=C1
Synonyms:
  • 5H-2-Benzazepin-5-one, 8-chloro-1-(2-fluoro-6-methoxyphenyl)-3,4-dihydro-
  • 8-Chloro-1-(2-fluoro-6-methoxyphenyl)-3,4-dihydro-5H-2-benzazepin-5-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.