CymitQuimica logo

CAS 86945-24-6

:

1,2,3,4-Tetrahydro-1-naphthaleneethanamine

Description:
1,2,3,4-Tetrahydro-1-naphthaleneethanamine, with the CAS number 86945-24-6, is an organic compound characterized by its bicyclic structure, which includes a naphthalene moiety and an ethylamine functional group. This compound features a saturated naphthalene ring system, contributing to its unique physical and chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the amine group suggests that it can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, it may exhibit basic properties due to the nitrogen atom, allowing it to act as a nucleophile in various chemical reactions. The compound's structure may also impart specific biological activities, making it of interest in medicinal chemistry and drug development. However, detailed information regarding its toxicity, stability, and reactivity should be consulted from safety data sheets or specific literature for safe handling and application.
Formula:C12H17N
InChI:InChI=1S/C12H17N/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-2,4,7,11H,3,5-6,8-9,13H2
InChI key:InChIKey=MDZDZKKIXUPBSY-UHFFFAOYSA-N
SMILES:C(CN)C1C=2C(CCC1)=CC=CC2
Synonyms:
  • 2-(1,2,3,4-Tetrahydronaphthalen-1-yl)ethan-1-amine
  • 1,2,3,4-Tetrahydro-1-naphthaleneethanamine
  • 1-Naphthaleneethanamine, 1,2,3,4-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.