CAS 86945-27-9
:1-Benzyl-4-cyanomethylpiperidine-4-carbonitrile
Description:
1-Benzyl-4-cyanomethylpiperidine-4-carbonitrile, identified by its CAS number 86945-27-9, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted with a benzyl group and two cyano groups. The presence of the cyano groups (-C≡N) indicates that it has potential applications in organic synthesis and medicinal chemistry, as cyano groups can serve as versatile intermediates in various chemical reactions. The compound is typically characterized by its molecular structure, which influences its physical and chemical properties, such as solubility, boiling point, and reactivity. Additionally, due to the presence of both the benzyl and cyano functionalities, it may exhibit interesting biological activities, making it a subject of interest in pharmaceutical research. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C15H17N3
InChI:InChI=1/C15H17N3/c16-9-6-15(13-17)7-10-18(11-8-15)12-14-4-2-1-3-5-14/h1-5H,6-8,10-12H2
SMILES:c1ccc(cc1)CN1CCC(CC#N)(CC1)C#N
Synonyms:- 1-Benzyl-4-(cyanomethyl)piperidine-4-carbonitrile
- 4-Piperidineacetonitrile, 4-Cyano-1-(Phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
